About diethyl 2-acetylhexanedioate
diethyl 2-acetylhexanedioate (PubChem CID 11021125) has the molecular formula C12H20O5
and a molecular weight of 244.29 g/mol. Its IUPAC name is diethyl 2-acetylhexanedioate.
Molecular Properties
| Compound Name | diethyl 2-acetylhexanedioate |
| PubChem CID | 11021125 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | diethyl 2-acetylhexanedioate |
| SMILES | CCOC(=O)CCCC(C(C)=O)C(=O)OCC |
| InChI | InChI=1S/C12H20O5/c1-4-16-11(14)8-6-7-10(9(3)13)12(15)17-5-2/h10H,4-8H2,1-3H3 |
| InChIKey | PERUQADVYIVQCB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-acetylhexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-acetylhexanedioate?
The IUPAC name of diethyl 2-acetylhexanedioate (CID 11021125) is diethyl 2-acetylhexanedioate.
What is the SMILES notation for diethyl 2-acetylhexanedioate?
The canonical SMILES for diethyl 2-acetylhexanedioate is CCOC(=O)CCCC(C(C)=O)C(=O)OCC.
What is the InChIKey of diethyl 2-acetylhexanedioate?
The InChIKey is PERUQADVYIVQCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O5/c1-4-16-11(14)8-6-7-10(9(3)13)12(15)17-5-2/h10H,4-8H2,1-3H3.
What are the key properties of diethyl 2-acetylhexanedioate?
diethyl 2-acetylhexanedioate has a molecular weight of 244.29 g/mol, XLogP of 1.49, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-acetylhexanedioate is sourced from PubChem (CID 11021125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).