C17H27N5O — CID 110211318
4-[5-[[(3R)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]pyrimidin-2-yl]morpholine (PubChem CID 110211318) has the molecular formula C17H27N5O and a molecular weight of 317.44 g/mol. Its IUPAC name is 4-[5-[[(3R)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]pyrimidin-2-yl]morpholine.
| Compound Name | 4-[5-[[(3R)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]pyrimidin-2-yl]morpholine |
|---|---|
| PubChem CID | 110211318 |
| Molecular Formula | C17H27N5O |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.22 |
| IUPAC Name | 4-[5-[[(3R)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]pyrimidin-2-yl]morpholine |
| SMILES | C[C@@H]1CN2CCCC2CN1Cc1cnc(N2CCOCC2)nc1 |
| InChI | InChI=1S/C17H27N5O/c1-14-11-21-4-2-3-16(21)13-22(14)12-15-9-18-17(19-10-15)20-5-7-23-8-6-20/h9-10,14,16H,2-8,11-13H2,1H3/t14-,16?/m1/s1 |
| InChIKey | MRCWZGHVMOHAFZ-IURRXHLWSA-N |
| XLogP | 0.98 |
| TPSA | 44.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |