About CID 110211761
CID 110211761 (PubChem CID 110211761) has the molecular formula C25H24N4O3
and a molecular weight of 428.49 g/mol.
Molecular Properties
| Compound Name | CID 110211761 |
| PubChem CID | 110211761 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | — |
| SMILES | O=C1NC2(COC3(CCN(C(=O)c4cccc5ncccc45)CC3)C2)Nc2ccccc21 |
| InChI | InChI=1S/C25H24N4O3/c30-22-19-5-1-2-8-21(19)27-25(28-22)15-24(32-16-25)10-13-29(14-11-24)23(31)18-6-3-9-20-17(18)7-4-12-26-20/h1-9,12,27H,10-11,13-16H2,(H,28,30) |
| InChIKey | MINSZPYAQWJWNJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 110211761 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 110211761?
The IUPAC name of CID 110211761 (CID 110211761) is not available.
What is the SMILES notation for CID 110211761?
The canonical SMILES for CID 110211761 is O=C1NC2(COC3(CCN(C(=O)c4cccc5ncccc45)CC3)C2)Nc2ccccc21.
What is the InChIKey of CID 110211761?
The InChIKey is MINSZPYAQWJWNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24N4O3/c30-22-19-5-1-2-8-21(19)27-25(28-22)15-24(32-16-25)10-13-29(14-11-24)23(31)18-6-3-9-20-17(18)7-4-12-26-20/h1-9,12,27H,10-11,13-16H2,(H,28,30).
What are the key properties of CID 110211761?
CID 110211761 has a molecular weight of 428.49 g/mol, XLogP of 3.18, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 110211761 is sourced from PubChem (CID 110211761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).