C22H23F2N3O2 — CID 110211837
CID 110211837 (PubChem CID 110211837) has the molecular formula C22H23F2N3O2 and a molecular weight of 399.44 g/mol.
| Compound Name | CID 110211837 |
|---|---|
| PubChem CID | 110211837 |
| Molecular Formula | C22H23F2N3O2 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | — |
| SMILES | O=C1NC2(COC3(CCN(Cc4c(F)cccc4F)CC3)C2)Nc2ccccc21 |
| InChI | InChI=1S/C22H23F2N3O2/c23-17-5-3-6-18(24)16(17)12-27-10-8-21(9-11-27)13-22(14-29-21)25-19-7-2-1-4-15(19)20(28)26-22/h1-7,25H,8-14H2,(H,26,28) |
| InChIKey | SXNYDESKQAWFKX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |