About methyl (2Z)-2-azido-2-[(3,5-dimethylphenyl)hydrazinylidene]acetate
methyl (2Z)-2-azido-2-[(3,5-dimethylphenyl)hydrazinylidene]acetate (PubChem CID 11021212) has the molecular formula C11H13N5O2
and a molecular weight of 247.26 g/mol. Its IUPAC name is methyl (2Z)-2-azido-2-[(3,5-dimethylphenyl)hydrazinylidene]acetate.
Molecular Properties
| Compound Name | methyl (2Z)-2-azido-2-[(3,5-dimethylphenyl)hydrazinylidene]acetate |
| PubChem CID | 11021212 |
| Molecular Formula | C11H13N5O2 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | methyl (2Z)-2-azido-2-[(3,5-dimethylphenyl)hydrazinylidene]acetate |
| SMILES | COC(=O)/C(N=[N+]=[N-])=N/Nc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C11H13N5O2/c1-7-4-8(2)6-9(5-7)13-14-10(15-16-12)11(17)18-3/h4-6,13H,1-3H3/b14-10- |
| InChIKey | WTVWNTUBIVWADK-UVTDQMKNSA-N |
| XLogP | 2.51 |
| TPSA | 99.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl (2Z)-2-azido-2-[(3,5-dimethylphenyl)hydrazinylidene]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2Z)-2-azido-2-[(3,5-dimethylphenyl)hydrazinylidene]acetate?
The IUPAC name of methyl (2Z)-2-azido-2-[(3,5-dimethylphenyl)hydrazinylidene]acetate (CID 11021212) is methyl (2Z)-2-azido-2-[(3,5-dimethylphenyl)hydrazinylidene]acetate.
What is the SMILES notation for methyl (2Z)-2-azido-2-[(3,5-dimethylphenyl)hydrazinylidene]acetate?
The canonical SMILES for methyl (2Z)-2-azido-2-[(3,5-dimethylphenyl)hydrazinylidene]acetate is COC(=O)/C(N=[N+]=[N-])=N/Nc1cc(C)cc(C)c1.
What is the InChIKey of methyl (2Z)-2-azido-2-[(3,5-dimethylphenyl)hydrazinylidene]acetate?
The InChIKey is WTVWNTUBIVWADK-UVTDQMKNSA-N. The full InChI is InChI=1S/C11H13N5O2/c1-7-4-8(2)6-9(5-7)13-14-10(15-16-12)11(17)18-3/h4-6,13H,1-3H3/b14-10-.
What are the key properties of methyl (2Z)-2-azido-2-[(3,5-dimethylphenyl)hydrazinylidene]acetate?
methyl (2Z)-2-azido-2-[(3,5-dimethylphenyl)hydrazinylidene]acetate has a molecular weight of 247.26 g/mol, XLogP of 2.51, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2Z)-2-azido-2-[(3,5-dimethylphenyl)hydrazinylidene]acetate is sourced from PubChem (CID 11021212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).