C19H21N5O4S — CID 110212306
2-(2',4-dioxospiro[3H-1,3-benzoxazine-2,5'-azepane]-1'-yl)-N-(5-methyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 110212306) has the molecular formula C19H21N5O4S and a molecular weight of 415.48 g/mol. Its IUPAC name is 2-(2',4-dioxospiro[3H-1,3-benzoxazine-2,5'-azepane]-1'-yl)-N-(5-methyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | 2-(2',4-dioxospiro[3H-1,3-benzoxazine-2,5'-azepane]-1'-yl)-N-(5-methyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 110212306 |
| Molecular Formula | C19H21N5O4S |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 2-(2',4-dioxospiro[3H-1,3-benzoxazine-2,5'-azepane]-1'-yl)-N-(5-methyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | Cc1nnc(NC(=O)C(C)N2CCC3(CCC2=O)NC(=O)c2ccccc2O3)s1 |
| InChI | InChI=1S/C19H21N5O4S/c1-11(16(26)20-18-23-22-12(2)29-18)24-10-9-19(8-7-15(24)25)21-17(27)13-5-3-4-6-14(13)28-19/h3-6,11H,7-10H2,1-2H3,(H,21,27)(H,20,23,26) |
| InChIKey | VGWVNBQXBQHNSO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |