About 1-phenylhepta-1,6-dienylbenzene
1-phenylhepta-1,6-dienylbenzene (PubChem CID 11021254) has the molecular formula C19H20
and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-phenylhepta-1,6-dienylbenzene.
Molecular Properties
| Compound Name | 1-phenylhepta-1,6-dienylbenzene |
| PubChem CID | 11021254 |
| Molecular Formula | C19H20 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 1-phenylhepta-1,6-dienylbenzene |
| SMILES | C=CCCCC=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H20/c1-2-3-4-11-16-19(17-12-7-5-8-13-17)18-14-9-6-10-15-18/h2,5-10,12-16H,1,3-4,11H2 |
| InChIKey | MYRNEKRGKLPZGC-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylhepta-1,6-dienylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylhepta-1,6-dienylbenzene?
The IUPAC name of 1-phenylhepta-1,6-dienylbenzene (CID 11021254) is 1-phenylhepta-1,6-dienylbenzene.
What is the SMILES notation for 1-phenylhepta-1,6-dienylbenzene?
The canonical SMILES for 1-phenylhepta-1,6-dienylbenzene is C=CCCCC=C(c1ccccc1)c1ccccc1.
What is the InChIKey of 1-phenylhepta-1,6-dienylbenzene?
The InChIKey is MYRNEKRGKLPZGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20/c1-2-3-4-11-16-19(17-12-7-5-8-13-17)18-14-9-6-10-15-18/h2,5-10,12-16H,1,3-4,11H2.
What are the key properties of 1-phenylhepta-1,6-dienylbenzene?
1-phenylhepta-1,6-dienylbenzene has a molecular weight of 248.37 g/mol, XLogP of 5.47, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylhepta-1,6-dienylbenzene is sourced from PubChem (CID 11021254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).