About CID 110212554
CID 110212554 (PubChem CID 110212554) has the molecular formula C23H24ClN3OS
and a molecular weight of 425.99 g/mol.
Molecular Properties
| Compound Name | CID 110212554 |
| PubChem CID | 110212554 |
| Molecular Formula | C23H24ClN3OS |
| Molecular Weight | 425.99 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | — |
| SMILES | Clc1ccc2c(c1)NC1(COC3(CCN(Cc4cccs4)CC3)C1)c1cccn1-2 |
| InChI | InChI=1S/C23H24ClN3OS/c24-17-5-6-20-19(13-17)25-23(21-4-1-9-27(20)21)15-22(28-16-23)7-10-26(11-8-22)14-18-3-2-12-29-18/h1-6,9,12-13,25H,7-8,10-11,14-16H2 |
| InChIKey | VADDEGHRPPTJLJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 29.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.99 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 110212554 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 110212554?
The IUPAC name of CID 110212554 (CID 110212554) is not available.
What is the SMILES notation for CID 110212554?
The canonical SMILES for CID 110212554 is Clc1ccc2c(c1)NC1(COC3(CCN(Cc4cccs4)CC3)C1)c1cccn1-2.
What is the InChIKey of CID 110212554?
The InChIKey is VADDEGHRPPTJLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24ClN3OS/c24-17-5-6-20-19(13-17)25-23(21-4-1-9-27(20)21)15-22(28-16-23)7-10-26(11-8-22)14-18-3-2-12-29-18/h1-6,9,12-13,25H,7-8,10-11,14-16H2.
What are the key properties of CID 110212554?
CID 110212554 has a molecular weight of 425.99 g/mol, XLogP of 5.27, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 110212554 is sourced from PubChem (CID 110212554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).