About CID 110212556
CID 110212556 (PubChem CID 110212556) has the molecular formula C25H27ClN4O
and a molecular weight of 434.97 g/mol.
Molecular Properties
| Compound Name | CID 110212556 |
| PubChem CID | 110212556 |
| Molecular Formula | C25H27ClN4O |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | — |
| SMILES | Cc1cccc(CN2CCC3(CC2)CC2(CO3)Nc3cc(Cl)ccc3-n3cccc32)n1 |
| InChI | InChI=1S/C25H27ClN4O/c1-18-4-2-5-20(27-18)15-29-12-9-24(10-13-29)16-25(17-31-24)23-6-3-11-30(23)22-8-7-19(26)14-21(22)28-25/h2-8,11,14,28H,9-10,12-13,15-17H2,1H3 |
| InChIKey | BRWYRFQOUCHKGW-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 110212556 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 110212556?
The IUPAC name of CID 110212556 (CID 110212556) is not available.
What is the SMILES notation for CID 110212556?
The canonical SMILES for CID 110212556 is Cc1cccc(CN2CCC3(CC2)CC2(CO3)Nc3cc(Cl)ccc3-n3cccc32)n1.
What is the InChIKey of CID 110212556?
The InChIKey is BRWYRFQOUCHKGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27ClN4O/c1-18-4-2-5-20(27-18)15-29-12-9-24(10-13-29)16-25(17-31-24)23-6-3-11-30(23)22-8-7-19(26)14-21(22)28-25/h2-8,11,14,28H,9-10,12-13,15-17H2,1H3.
What are the key properties of CID 110212556?
CID 110212556 has a molecular weight of 434.97 g/mol, XLogP of 4.91, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 110212556 is sourced from PubChem (CID 110212556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).