C22H28N4O3 — CID 110212933
[2-methoxy-5-[(5-morpholin-4-yl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl)methyl]phenyl]methanol (PubChem CID 110212933) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is [2-methoxy-5-[(5-morpholin-4-yl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl)methyl]phenyl]methanol.
| Compound Name | [2-methoxy-5-[(5-morpholin-4-yl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl)methyl]phenyl]methanol |
|---|---|
| PubChem CID | 110212933 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | [2-methoxy-5-[(5-morpholin-4-yl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl)methyl]phenyl]methanol |
| SMILES | COc1ccc(CN2C3CCC2c2cnc(N4CCOCC4)nc2C3)cc1CO |
| InChI | InChI=1S/C22H28N4O3/c1-28-21-5-2-15(10-16(21)14-27)13-26-17-3-4-20(26)18-12-23-22(24-19(18)11-17)25-6-8-29-9-7-25/h2,5,10,12,17,20,27H,3-4,6-9,11,13-14H2,1H3 |
| InChIKey | AUVSKCSTVUMMBU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |