C18H23ClN6O3S — CID 110212972
4-[12-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-5-yl]morpholine (PubChem CID 110212972) has the molecular formula C18H23ClN6O3S and a molecular weight of 438.94 g/mol. Its IUPAC name is 4-[12-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-5-yl]morpholine.
| Compound Name | 4-[12-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-5-yl]morpholine |
|---|---|
| PubChem CID | 110212972 |
| Molecular Formula | C18H23ClN6O3S |
| Molecular Weight | 438.94 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 4-[12-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-5-yl]morpholine |
| SMILES | Cc1nn(C)c(Cl)c1S(=O)(=O)N1C2CCC1c1cnc(N3CCOCC3)nc1C2 |
| InChI | InChI=1S/C18H23ClN6O3S/c1-11-16(17(19)23(2)22-11)29(26,27)25-12-3-4-15(25)13-10-20-18(21-14(13)9-12)24-5-7-28-8-6-24/h10,12,15H,3-9H2,1-2H3 |
| InChIKey | AWKACRPYMYATAW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 93.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.94 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |