C21H27N3O4 — CID 110213089
2-(7-methyl-2',5-dioxospiro[3,4-dihydro-1,4-benzoxazepine-2,5'-azepane]-1'-yl)-N-prop-2-enylpropanamide (PubChem CID 110213089) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is 2-(7-methyl-2',5-dioxospiro[3,4-dihydro-1,4-benzoxazepine-2,5'-azepane]-1'-yl)-N-prop-2-enylpropanamide.
| Compound Name | 2-(7-methyl-2',5-dioxospiro[3,4-dihydro-1,4-benzoxazepine-2,5'-azepane]-1'-yl)-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 110213089 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 2-(7-methyl-2',5-dioxospiro[3,4-dihydro-1,4-benzoxazepine-2,5'-azepane]-1'-yl)-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)C(C)N1CCC2(CCC1=O)CNC(=O)c1cc(C)ccc1O2 |
| InChI | InChI=1S/C21H27N3O4/c1-4-10-22-19(26)15(3)24-11-9-21(8-7-18(24)25)13-23-20(27)16-12-14(2)5-6-17(16)28-21/h4-6,12,15H,1,7-11,13H2,2-3H3,(H,22,26)(H,23,27) |
| InChIKey | HHUWYPCQLBRIFN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|