About 2-(2,5-dimethyl-1H-pyrrol-3-yl)naphthalene-1,4-dione
2-(2,5-dimethyl-1H-pyrrol-3-yl)naphthalene-1,4-dione (PubChem CID 11021338) has the molecular formula C16H13NO2
and a molecular weight of 251.28 g/mol. Its IUPAC name is 2-(2,5-dimethyl-1H-pyrrol-3-yl)naphthalene-1,4-dione.
Molecular Properties
| Compound Name | 2-(2,5-dimethyl-1H-pyrrol-3-yl)naphthalene-1,4-dione |
| PubChem CID | 11021338 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 2-(2,5-dimethyl-1H-pyrrol-3-yl)naphthalene-1,4-dione |
| SMILES | Cc1cc(C2=CC(=O)c3ccccc3C2=O)c(C)[nH]1 |
| InChI | InChI=1S/C16H13NO2/c1-9-7-13(10(2)17-9)14-8-15(18)11-5-3-4-6-12(11)16(14)19/h3-8,17H,1-2H3 |
| InChIKey | UHATZWVOLWRXHZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dimethyl-1H-pyrrol-3-yl)naphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethyl-1H-pyrrol-3-yl)naphthalene-1,4-dione?
The IUPAC name of 2-(2,5-dimethyl-1H-pyrrol-3-yl)naphthalene-1,4-dione (CID 11021338) is 2-(2,5-dimethyl-1H-pyrrol-3-yl)naphthalene-1,4-dione.
What is the SMILES notation for 2-(2,5-dimethyl-1H-pyrrol-3-yl)naphthalene-1,4-dione?
The canonical SMILES for 2-(2,5-dimethyl-1H-pyrrol-3-yl)naphthalene-1,4-dione is Cc1cc(C2=CC(=O)c3ccccc3C2=O)c(C)[nH]1.
What is the InChIKey of 2-(2,5-dimethyl-1H-pyrrol-3-yl)naphthalene-1,4-dione?
The InChIKey is UHATZWVOLWRXHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO2/c1-9-7-13(10(2)17-9)14-8-15(18)11-5-3-4-6-12(11)16(14)19/h3-8,17H,1-2H3.
What are the key properties of 2-(2,5-dimethyl-1H-pyrrol-3-yl)naphthalene-1,4-dione?
2-(2,5-dimethyl-1H-pyrrol-3-yl)naphthalene-1,4-dione has a molecular weight of 251.28 g/mol, XLogP of 3.09, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethyl-1H-pyrrol-3-yl)naphthalene-1,4-dione is sourced from PubChem (CID 11021338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).