About 2-(1,3-dithiol-2-ylidene)-1,3-benzodithiole
2-(1,3-dithiol-2-ylidene)-1,3-benzodithiole (PubChem CID 11021453) has the molecular formula C10H6S4
and a molecular weight of 254.43 g/mol. Its IUPAC name is 2-(1,3-dithiol-2-ylidene)-1,3-benzodithiole.
Molecular Properties
| Compound Name | 2-(1,3-dithiol-2-ylidene)-1,3-benzodithiole |
| PubChem CID | 11021453 |
| Molecular Formula | C10H6S4 |
| Molecular Weight | 254.43 g/mol |
| Exact Mass | 253.94 |
| IUPAC Name | 2-(1,3-dithiol-2-ylidene)-1,3-benzodithiole |
| SMILES | C1=CSC(=C2Sc3ccccc3S2)S1 |
| InChI | InChI=1S/C10H6S4/c1-2-4-8-7(3-1)13-10(14-8)9-11-5-6-12-9/h1-6H |
| InChIKey | XLFFNEMADNGPRL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.43 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,3-dithiol-2-ylidene)-1,3-benzodithiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dithiol-2-ylidene)-1,3-benzodithiole?
The IUPAC name of 2-(1,3-dithiol-2-ylidene)-1,3-benzodithiole (CID 11021453) is 2-(1,3-dithiol-2-ylidene)-1,3-benzodithiole.
What is the SMILES notation for 2-(1,3-dithiol-2-ylidene)-1,3-benzodithiole?
The canonical SMILES for 2-(1,3-dithiol-2-ylidene)-1,3-benzodithiole is C1=CSC(=C2Sc3ccccc3S2)S1.
What is the InChIKey of 2-(1,3-dithiol-2-ylidene)-1,3-benzodithiole?
The InChIKey is XLFFNEMADNGPRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6S4/c1-2-4-8-7(3-1)13-10(14-8)9-11-5-6-12-9/h1-6H.
What are the key properties of 2-(1,3-dithiol-2-ylidene)-1,3-benzodithiole?
2-(1,3-dithiol-2-ylidene)-1,3-benzodithiole has a molecular weight of 254.43 g/mol, XLogP of 4.96, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dithiol-2-ylidene)-1,3-benzodithiole is sourced from PubChem (CID 11021453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).