About 2-[1-[5-ethyl-4-(methoxymethyl)furan-2-carbonyl]piperidin-4-yl]-2,3-dihydrochromen-4-one
2-[1-[5-ethyl-4-(methoxymethyl)furan-2-carbonyl]piperidin-4-yl]-2,3-dihydrochromen-4-one (PubChem CID 110214936) has the molecular formula C23H27NO5
and a molecular weight of 397.47 g/mol. Its IUPAC name is 2-[1-[5-ethyl-4-(methoxymethyl)furan-2-carbonyl]piperidin-4-yl]-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 2-[1-[5-ethyl-4-(methoxymethyl)furan-2-carbonyl]piperidin-4-yl]-2,3-dihydrochromen-4-one |
| PubChem CID | 110214936 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 2-[1-[5-ethyl-4-(methoxymethyl)furan-2-carbonyl]piperidin-4-yl]-2,3-dihydrochromen-4-one |
| SMILES | CCc1oc(C(=O)N2CCC(C3CC(=O)c4ccccc4O3)CC2)cc1COC |
| InChI | InChI=1S/C23H27NO5/c1-3-19-16(14-27-2)12-22(28-19)23(26)24-10-8-15(9-11-24)21-13-18(25)17-6-4-5-7-20(17)29-21/h4-7,12,15,21H,3,8-11,13-14H2,1-2H3 |
| InChIKey | XNSOJWOWFQYPQW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[1-[5-ethyl-4-(methoxymethyl)furan-2-carbonyl]piperidin-4-yl]-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[5-ethyl-4-(methoxymethyl)furan-2-carbonyl]piperidin-4-yl]-2,3-dihydrochromen-4-one?
The IUPAC name of 2-[1-[5-ethyl-4-(methoxymethyl)furan-2-carbonyl]piperidin-4-yl]-2,3-dihydrochromen-4-one (CID 110214936) is 2-[1-[5-ethyl-4-(methoxymethyl)furan-2-carbonyl]piperidin-4-yl]-2,3-dihydrochromen-4-one.
What is the SMILES notation for 2-[1-[5-ethyl-4-(methoxymethyl)furan-2-carbonyl]piperidin-4-yl]-2,3-dihydrochromen-4-one?
The canonical SMILES for 2-[1-[5-ethyl-4-(methoxymethyl)furan-2-carbonyl]piperidin-4-yl]-2,3-dihydrochromen-4-one is CCc1oc(C(=O)N2CCC(C3CC(=O)c4ccccc4O3)CC2)cc1COC.
What is the InChIKey of 2-[1-[5-ethyl-4-(methoxymethyl)furan-2-carbonyl]piperidin-4-yl]-2,3-dihydrochromen-4-one?
The InChIKey is XNSOJWOWFQYPQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27NO5/c1-3-19-16(14-27-2)12-22(28-19)23(26)24-10-8-15(9-11-24)21-13-18(25)17-6-4-5-7-20(17)29-21/h4-7,12,15,21H,3,8-11,13-14H2,1-2H3.
What are the key properties of 2-[1-[5-ethyl-4-(methoxymethyl)furan-2-carbonyl]piperidin-4-yl]-2,3-dihydrochromen-4-one?
2-[1-[5-ethyl-4-(methoxymethyl)furan-2-carbonyl]piperidin-4-yl]-2,3-dihydrochromen-4-one has a molecular weight of 397.47 g/mol, XLogP of 3.87, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[5-ethyl-4-(methoxymethyl)furan-2-carbonyl]piperidin-4-yl]-2,3-dihydrochromen-4-one is sourced from PubChem (CID 110214936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).