C19H19N5O — CID 110215069
(2-methyl-3-pyridinyl)-(7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl)methanone (PubChem CID 110215069) has the molecular formula C19H19N5O and a molecular weight of 333.40 g/mol. Its IUPAC name is (2-methyl-3-pyridinyl)-(7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl)methanone.
| Compound Name | (2-methyl-3-pyridinyl)-(7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl)methanone |
|---|---|
| PubChem CID | 110215069 |
| Molecular Formula | C19H19N5O |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (2-methyl-3-pyridinyl)-(7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl)methanone |
| SMILES | Cc1cc2ncc3c(n2n1)CC1CCC3N1C(=O)c1cccnc1C |
| InChI | InChI=1S/C19H19N5O/c1-11-8-18-21-10-15-16-6-5-13(9-17(15)24(18)22-11)23(16)19(25)14-4-3-7-20-12(14)2/h3-4,7-8,10,13,16H,5-6,9H2,1-2H3 |
| InChIKey | WBACHGUNOLETIC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |