C25H30N4O2 — CID 110215264
15-[(4-ethoxy-3-methoxy-5-prop-2-enylphenyl)methyl]-7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraene (PubChem CID 110215264) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is 15-[(4-ethoxy-3-methoxy-5-prop-2-enylphenyl)methyl]-7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraene.
| Compound Name | 15-[(4-ethoxy-3-methoxy-5-prop-2-enylphenyl)methyl]-7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraene |
|---|---|
| PubChem CID | 110215264 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 15-[(4-ethoxy-3-methoxy-5-prop-2-enylphenyl)methyl]-7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraene |
| SMILES | C=CCc1cc(CN2C3CCC2c2cnc4cc(C)nn4c2C3)cc(OC)c1OCC |
| InChI | InChI=1S/C25H30N4O2/c1-5-7-18-11-17(12-23(30-4)25(18)31-6-2)15-28-19-8-9-21(28)20-14-26-24-10-16(3)27-29(24)22(20)13-19/h5,10-12,14,19,21H,1,6-9,13,15H2,2-4H3 |
| InChIKey | LHNFPUSDUVHYRS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 51.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|