About (1S,4R)-6-[tert-butyl(dimethyl)silyl]oxycyclohept-2-ene-1,4-diol
(1S,4R)-6-[tert-butyl(dimethyl)silyl]oxycyclohept-2-ene-1,4-diol (PubChem CID 11021568) has the molecular formula C13H26O3Si
and a molecular weight of 258.43 g/mol. Its IUPAC name is (1S,4R)-6-[tert-butyl(dimethyl)silyl]oxycyclohept-2-ene-1,4-diol.
Molecular Properties
| Compound Name | (1S,4R)-6-[tert-butyl(dimethyl)silyl]oxycyclohept-2-ene-1,4-diol |
| PubChem CID | 11021568 |
| Molecular Formula | C13H26O3Si |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (1S,4R)-6-[tert-butyl(dimethyl)silyl]oxycyclohept-2-ene-1,4-diol |
| SMILES | CC(C)(C)[Si](C)(C)OC1C[C@H](O)C=C[C@H](O)C1 |
| InChI | InChI=1S/C13H26O3Si/c1-13(2,3)17(4,5)16-12-8-10(14)6-7-11(15)9-12/h6-7,10-12,14-15H,8-9H2,1-5H3/t10-,11+,12? |
| InChIKey | OYEIGEOUTPUFET-FOSCPWQOSA-N |
| XLogP | 2.45 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1S,4R)-6-[tert-butyl(dimethyl)silyl]oxycyclohept-2-ene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,4R)-6-[tert-butyl(dimethyl)silyl]oxycyclohept-2-ene-1,4-diol?
The IUPAC name of (1S,4R)-6-[tert-butyl(dimethyl)silyl]oxycyclohept-2-ene-1,4-diol (CID 11021568) is (1S,4R)-6-[tert-butyl(dimethyl)silyl]oxycyclohept-2-ene-1,4-diol.
What is the SMILES notation for (1S,4R)-6-[tert-butyl(dimethyl)silyl]oxycyclohept-2-ene-1,4-diol?
The canonical SMILES for (1S,4R)-6-[tert-butyl(dimethyl)silyl]oxycyclohept-2-ene-1,4-diol is CC(C)(C)[Si](C)(C)OC1C[C@H](O)C=C[C@H](O)C1.
What is the InChIKey of (1S,4R)-6-[tert-butyl(dimethyl)silyl]oxycyclohept-2-ene-1,4-diol?
The InChIKey is OYEIGEOUTPUFET-FOSCPWQOSA-N. The full InChI is InChI=1S/C13H26O3Si/c1-13(2,3)17(4,5)16-12-8-10(14)6-7-11(15)9-12/h6-7,10-12,14-15H,8-9H2,1-5H3/t10-,11+,12?.
What are the key properties of (1S,4R)-6-[tert-butyl(dimethyl)silyl]oxycyclohept-2-ene-1,4-diol?
(1S,4R)-6-[tert-butyl(dimethyl)silyl]oxycyclohept-2-ene-1,4-diol has a molecular weight of 258.43 g/mol, XLogP of 2.45, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,4R)-6-[tert-butyl(dimethyl)silyl]oxycyclohept-2-ene-1,4-diol is sourced from PubChem (CID 11021568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).