C15H17NO3 — CID 11021587
(4aS,5R)-5-phenylmethoxy-4a,5,6,7-tetrahydro-2H-pyrido[1,2-b]oxazin-8-one (PubChem CID 11021587) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is (4aS,5R)-5-phenylmethoxy-4a,5,6,7-tetrahydro-2H-pyrido[1,2-b]oxazin-8-one.
| Compound Name | (4aS,5R)-5-phenylmethoxy-4a,5,6,7-tetrahydro-2H-pyrido[1,2-b]oxazin-8-one |
|---|---|
| PubChem CID | 11021587 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (4aS,5R)-5-phenylmethoxy-4a,5,6,7-tetrahydro-2H-pyrido[1,2-b]oxazin-8-one |
| SMILES | O=C1CC[C@@H](OCc2ccccc2)[C@@H]2C=CCON12 |
| InChI | InChI=1S/C15H17NO3/c17-15-9-8-14(13-7-4-10-19-16(13)15)18-11-12-5-2-1-3-6-12/h1-7,13-14H,8-11H2/t13-,14+/m0/s1 |
| InChIKey | ZOCZOIINKPOEDO-UONOGXRCSA-N |
| XLogP | 2.06 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|