About 4-[(5-chloropyrrolo[3,2-b]pyridin-1-yl)methyl]-1-(cyclohex-3-en-1-ylmethyl)piperidin-4-ol
4-[(5-chloropyrrolo[3,2-b]pyridin-1-yl)methyl]-1-(cyclohex-3-en-1-ylmethyl)piperidin-4-ol (PubChem CID 110216346) has the molecular formula C20H26ClN3O
and a molecular weight of 359.90 g/mol. Its IUPAC name is 4-[(5-chloropyrrolo[3,2-b]pyridin-1-yl)methyl]-1-(cyclohex-3-en-1-ylmethyl)piperidin-4-ol.
Molecular Properties
| Compound Name | 4-[(5-chloropyrrolo[3,2-b]pyridin-1-yl)methyl]-1-(cyclohex-3-en-1-ylmethyl)piperidin-4-ol |
| PubChem CID | 110216346 |
| Molecular Formula | C20H26ClN3O |
| Molecular Weight | 359.90 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 4-[(5-chloropyrrolo[3,2-b]pyridin-1-yl)methyl]-1-(cyclohex-3-en-1-ylmethyl)piperidin-4-ol |
| SMILES | OC1(Cn2ccc3nc(Cl)ccc32)CCN(CC2CC=CCC2)CC1 |
| InChI | InChI=1S/C20H26ClN3O/c21-19-7-6-18-17(22-19)8-11-24(18)15-20(25)9-12-23(13-10-20)14-16-4-2-1-3-5-16/h1-2,6-8,11,16,25H,3-5,9-10,12-15H2 |
| InChIKey | AOZDPYLWGJWJFF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.90 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(5-chloropyrrolo[3,2-b]pyridin-1-yl)methyl]-1-(cyclohex-3-en-1-ylmethyl)piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-chloropyrrolo[3,2-b]pyridin-1-yl)methyl]-1-(cyclohex-3-en-1-ylmethyl)piperidin-4-ol?
The IUPAC name of 4-[(5-chloropyrrolo[3,2-b]pyridin-1-yl)methyl]-1-(cyclohex-3-en-1-ylmethyl)piperidin-4-ol (CID 110216346) is 4-[(5-chloropyrrolo[3,2-b]pyridin-1-yl)methyl]-1-(cyclohex-3-en-1-ylmethyl)piperidin-4-ol.
What is the SMILES notation for 4-[(5-chloropyrrolo[3,2-b]pyridin-1-yl)methyl]-1-(cyclohex-3-en-1-ylmethyl)piperidin-4-ol?
The canonical SMILES for 4-[(5-chloropyrrolo[3,2-b]pyridin-1-yl)methyl]-1-(cyclohex-3-en-1-ylmethyl)piperidin-4-ol is OC1(Cn2ccc3nc(Cl)ccc32)CCN(CC2CC=CCC2)CC1.
What is the InChIKey of 4-[(5-chloropyrrolo[3,2-b]pyridin-1-yl)methyl]-1-(cyclohex-3-en-1-ylmethyl)piperidin-4-ol?
The InChIKey is AOZDPYLWGJWJFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26ClN3O/c21-19-7-6-18-17(22-19)8-11-24(18)15-20(25)9-12-23(13-10-20)14-16-4-2-1-3-5-16/h1-2,6-8,11,16,25H,3-5,9-10,12-15H2.
What are the key properties of 4-[(5-chloropyrrolo[3,2-b]pyridin-1-yl)methyl]-1-(cyclohex-3-en-1-ylmethyl)piperidin-4-ol?
4-[(5-chloropyrrolo[3,2-b]pyridin-1-yl)methyl]-1-(cyclohex-3-en-1-ylmethyl)piperidin-4-ol has a molecular weight of 359.90 g/mol, XLogP of 3.87, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-chloropyrrolo[3,2-b]pyridin-1-yl)methyl]-1-(cyclohex-3-en-1-ylmethyl)piperidin-4-ol is sourced from PubChem (CID 110216346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).