C24H32N2O3 — CID 110216448
3-[[3-(ethoxymethyl)-4-methoxyphenyl]methyl]-9-pyridin-2-yl-3-azabicyclo[3.3.1]nonan-9-ol (PubChem CID 110216448) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is 3-[[3-(ethoxymethyl)-4-methoxyphenyl]methyl]-9-pyridin-2-yl-3-azabicyclo[3.3.1]nonan-9-ol.
| Compound Name | 3-[[3-(ethoxymethyl)-4-methoxyphenyl]methyl]-9-pyridin-2-yl-3-azabicyclo[3.3.1]nonan-9-ol |
|---|---|
| PubChem CID | 110216448 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 3-[[3-(ethoxymethyl)-4-methoxyphenyl]methyl]-9-pyridin-2-yl-3-azabicyclo[3.3.1]nonan-9-ol |
| SMILES | CCOCc1cc(CN2CC3CCCC(C2)C3(O)c2ccccn2)ccc1OC |
| InChI | InChI=1S/C24H32N2O3/c1-3-29-17-19-13-18(10-11-22(19)28-2)14-26-15-20-7-6-8-21(16-26)24(20,27)23-9-4-5-12-25-23/h4-5,9-13,20-21,27H,3,6-8,14-17H2,1-2H3 |
| InChIKey | UESVCGQZUGZTDR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |