C14H15NO2S — CID 11021655
2-(benzenesulfonyl)octa-6,7-dienenitrile (PubChem CID 11021655) has the molecular formula C14H15NO2S and a molecular weight of 261.35 g/mol. Its IUPAC name is 2-(benzenesulfonyl)octa-6,7-dienenitrile.
| Compound Name | 2-(benzenesulfonyl)octa-6,7-dienenitrile |
|---|---|
| PubChem CID | 11021655 |
| Molecular Formula | C14H15NO2S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 2-(benzenesulfonyl)octa-6,7-dienenitrile |
| SMILES | C=C=CCCCC(C#N)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H15NO2S/c1-2-3-4-6-11-14(12-15)18(16,17)13-9-7-5-8-10-13/h3,5,7-10,14H,1,4,6,11H2 |
| InChIKey | MDDOVRYYFKZPBQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|