C16H13N3O — CID 11021716
7-methoxy-2-methyl-6,13,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene (PubChem CID 11021716) has the molecular formula C16H13N3O and a molecular weight of 263.30 g/mol. Its IUPAC name is 7-methoxy-2-methyl-6,13,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene.
| Compound Name | 7-methoxy-2-methyl-6,13,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene |
|---|---|
| PubChem CID | 11021716 |
| Molecular Formula | C16H13N3O |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 7-methoxy-2-methyl-6,13,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene |
| SMILES | COc1nccc2c(C)c3[nH]c4ccncc4c3cc12 |
| InChI | InChI=1S/C16H13N3O/c1-9-10-3-6-18-16(20-2)12(10)7-11-13-8-17-5-4-14(13)19-15(9)11/h3-8,19H,1-2H3 |
| InChIKey | MBZMDVDBPUVSNW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |