C15H20O4 — CID 11021755
(5S,5aS,9aS,9bR)-5-hydroxy-6,6,9a-trimethyl-5,5a,7,8,9,9b-hexahydrobenzo[e][2]benzofuran-1,3-dione (PubChem CID 11021755) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (5S,5aS,9aS,9bR)-5-hydroxy-6,6,9a-trimethyl-5,5a,7,8,9,9b-hexahydrobenzo[e][2]benzofuran-1,3-dione.
| Compound Name | (5S,5aS,9aS,9bR)-5-hydroxy-6,6,9a-trimethyl-5,5a,7,8,9,9b-hexahydrobenzo[e][2]benzofuran-1,3-dione |
|---|---|
| PubChem CID | 11021755 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (5S,5aS,9aS,9bR)-5-hydroxy-6,6,9a-trimethyl-5,5a,7,8,9,9b-hexahydrobenzo[e][2]benzofuran-1,3-dione |
| SMILES | CC1(C)CCC[C@]2(C)[C@H]3C(=O)OC(=O)C3=C[C@H](O)[C@@H]12 |
| InChI | InChI=1S/C15H20O4/c1-14(2)5-4-6-15(3)10-8(7-9(16)11(14)15)12(17)19-13(10)18/h7,9-11,16H,4-6H2,1-3H3/t9-,10+,11-,15+/m0/s1 |
| InChIKey | VZKUYNXPLWUXCJ-BQVMBELUSA-N |
| XLogP | 1.82 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|