About tert-butyl 3-(3-methyl-2-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-yl)piperidine-1-carboxylate
tert-butyl 3-(3-methyl-2-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-yl)piperidine-1-carboxylate (PubChem CID 110217959) has the molecular formula C18H27N3O3
and a molecular weight of 333.43 g/mol. Its IUPAC name is tert-butyl 3-(3-methyl-2-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-yl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3-(3-methyl-2-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-yl)piperidine-1-carboxylate |
| PubChem CID | 110217959 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | tert-butyl 3-(3-methyl-2-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-yl)piperidine-1-carboxylate |
| SMILES | Cc1c(C2CCCN(C(=O)OC(C)(C)C)C2)n2c(nc1=O)CCC2 |
| InChI | InChI=1S/C18H27N3O3/c1-12-15(21-10-6-8-14(21)19-16(12)22)13-7-5-9-20(11-13)17(23)24-18(2,3)4/h13H,5-11H2,1-4H3 |
| InChIKey | IIPOMZWLDBKZBH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 3-(3-methyl-2-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-yl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-(3-methyl-2-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-yl)piperidine-1-carboxylate?
The IUPAC name of tert-butyl 3-(3-methyl-2-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-yl)piperidine-1-carboxylate (CID 110217959) is tert-butyl 3-(3-methyl-2-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-yl)piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 3-(3-methyl-2-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-yl)piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 3-(3-methyl-2-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-yl)piperidine-1-carboxylate is Cc1c(C2CCCN(C(=O)OC(C)(C)C)C2)n2c(nc1=O)CCC2.
What is the InChIKey of tert-butyl 3-(3-methyl-2-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-yl)piperidine-1-carboxylate?
The InChIKey is IIPOMZWLDBKZBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N3O3/c1-12-15(21-10-6-8-14(21)19-16(12)22)13-7-5-9-20(11-13)17(23)24-18(2,3)4/h13H,5-11H2,1-4H3.
What are the key properties of tert-butyl 3-(3-methyl-2-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-yl)piperidine-1-carboxylate?
tert-butyl 3-(3-methyl-2-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-yl)piperidine-1-carboxylate has a molecular weight of 333.43 g/mol, XLogP of 2.61, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-(3-methyl-2-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-yl)piperidine-1-carboxylate is sourced from PubChem (CID 110217959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).