C18H21N5O — CID 110218001
(2-methylcyclopropyl)-[(2R,6R)-12-pyridin-4-yl-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-dien-4-yl]methanone (PubChem CID 110218001) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is (2-methylcyclopropyl)-[(2R,6R)-12-pyridin-4-yl-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-dien-4-yl]methanone.
| Compound Name | (2-methylcyclopropyl)-[(2R,6R)-12-pyridin-4-yl-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-dien-4-yl]methanone |
|---|---|
| PubChem CID | 110218001 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | (2-methylcyclopropyl)-[(2R,6R)-12-pyridin-4-yl-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-dien-4-yl]methanone |
| SMILES | CC1CC1C(=O)N1C[C@H]2CCc3nnc(-c4ccncc4)n3[C@H]2C1 |
| InChI | InChI=1S/C18H21N5O/c1-11-8-14(11)18(24)22-9-13-2-3-16-20-21-17(23(16)15(13)10-22)12-4-6-19-7-5-12/h4-7,11,13-15H,2-3,8-10H2,1H3/t11?,13-,14?,15+/m1/s1 |
| InChIKey | AIKRZOUVQRHWNY-CPWXKJDLSA-N |
| XLogP | 1.94 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |