C25H31N5O — CID 110218110
3-[4-(dimethylamino)phenyl]-1-[2-[4-(3-methyl-4-pyridinyl)-1H-pyrazol-5-yl]piperidin-1-yl]propan-1-one (PubChem CID 110218110) has the molecular formula C25H31N5O and a molecular weight of 417.56 g/mol. Its IUPAC name is 3-[4-(dimethylamino)phenyl]-1-[2-[4-(3-methyl-4-pyridinyl)-1H-pyrazol-5-yl]piperidin-1-yl]propan-1-one.
| Compound Name | 3-[4-(dimethylamino)phenyl]-1-[2-[4-(3-methyl-4-pyridinyl)-1H-pyrazol-5-yl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 110218110 |
| Molecular Formula | C25H31N5O |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | 3-[4-(dimethylamino)phenyl]-1-[2-[4-(3-methyl-4-pyridinyl)-1H-pyrazol-5-yl]piperidin-1-yl]propan-1-one |
| SMILES | Cc1cnccc1-c1cn[nH]c1C1CCCCN1C(=O)CCc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C25H31N5O/c1-18-16-26-14-13-21(18)22-17-27-28-25(22)23-6-4-5-15-30(23)24(31)12-9-19-7-10-20(11-8-19)29(2)3/h7-8,10-11,13-14,16-17,23H,4-6,9,12,15H2,1-3H3,(H,27,28) |
| InChIKey | LUAODVHMKOTLDP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|