C17H17NO2 — CID 11021865
3-benzyl-5-methyl-2-phenyl-1,3-oxazolidin-4-one (PubChem CID 11021865) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 3-benzyl-5-methyl-2-phenyl-1,3-oxazolidin-4-one.
| Compound Name | 3-benzyl-5-methyl-2-phenyl-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 11021865 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 3-benzyl-5-methyl-2-phenyl-1,3-oxazolidin-4-one |
| SMILES | CC1OC(c2ccccc2)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C17H17NO2/c1-13-16(19)18(12-14-8-4-2-5-9-14)17(20-13)15-10-6-3-7-11-15/h2-11,13,17H,12H2,1H3 |
| InChIKey | DAOPQIMANOFZGJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |