About (4R,5S)-4,5-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidin-2-one
(4R,5S)-4,5-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidin-2-one (PubChem CID 11021870) has the molecular formula C13H17NO3S
and a molecular weight of 267.35 g/mol. Its IUPAC name is (4R,5S)-4,5-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidin-2-one.
Molecular Properties
| Compound Name | (4R,5S)-4,5-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidin-2-one |
| PubChem CID | 11021870 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | (4R,5S)-4,5-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidin-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)C[C@@H](C)[C@@H]2C)cc1 |
| InChI | InChI=1S/C13H17NO3S/c1-9-4-6-12(7-5-9)18(16,17)14-11(3)10(2)8-13(14)15/h4-7,10-11H,8H2,1-3H3/t10-,11+/m1/s1 |
| InChIKey | XYTGWOOEBJPLPB-MNOVXSKESA-N |
| XLogP | 1.94 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R,5S)-4,5-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5S)-4,5-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidin-2-one?
The IUPAC name of (4R,5S)-4,5-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidin-2-one (CID 11021870) is (4R,5S)-4,5-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidin-2-one.
What is the SMILES notation for (4R,5S)-4,5-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidin-2-one?
The canonical SMILES for (4R,5S)-4,5-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidin-2-one is Cc1ccc(S(=O)(=O)N2C(=O)C[C@@H](C)[C@@H]2C)cc1.
What is the InChIKey of (4R,5S)-4,5-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidin-2-one?
The InChIKey is XYTGWOOEBJPLPB-MNOVXSKESA-N. The full InChI is InChI=1S/C13H17NO3S/c1-9-4-6-12(7-5-9)18(16,17)14-11(3)10(2)8-13(14)15/h4-7,10-11H,8H2,1-3H3/t10-,11+/m1/s1.
What are the key properties of (4R,5S)-4,5-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidin-2-one?
(4R,5S)-4,5-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidin-2-one has a molecular weight of 267.35 g/mol, XLogP of 1.94, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5S)-4,5-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidin-2-one is sourced from PubChem (CID 11021870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).