C15H26O4 — CID 11021961
2-[(1R,5R,6R)-6-(dimethoxymethyl)-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]acetic acid (PubChem CID 11021961) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is 2-[(1R,5R,6R)-6-(dimethoxymethyl)-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]acetic acid.
| Compound Name | 2-[(1R,5R,6R)-6-(dimethoxymethyl)-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]acetic acid |
|---|---|
| PubChem CID | 11021961 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 2-[(1R,5R,6R)-6-(dimethoxymethyl)-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]acetic acid |
| SMILES | COC(OC)[C@@H]1[C@@H](C(C)C)CC=C(C)[C@@H]1CC(=O)O |
| InChI | InChI=1S/C15H26O4/c1-9(2)11-7-6-10(3)12(8-13(16)17)14(11)15(18-4)19-5/h6,9,11-12,14-15H,7-8H2,1-5H3,(H,16,17)/t11-,12+,14-/m1/s1 |
| InChIKey | PLGKJONDACXHEQ-MBNYWOFBSA-N |
| XLogP | 2.93 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|