About 3-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]-1,3-benzoxazol-2-one
3-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]-1,3-benzoxazol-2-one (PubChem CID 110219622) has the molecular formula C18H22N4O2
and a molecular weight of 326.40 g/mol. Its IUPAC name is 3-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 3-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]-1,3-benzoxazol-2-one |
| PubChem CID | 110219622 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 3-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]-1,3-benzoxazol-2-one |
| SMILES | Cc1c(CN2CCCC(n3c(=O)oc4ccccc43)C2)cnn1C |
| InChI | InChI=1S/C18H22N4O2/c1-13-14(10-19-20(13)2)11-21-9-5-6-15(12-21)22-16-7-3-4-8-17(16)24-18(22)23/h3-4,7-8,10,15H,5-6,9,11-12H2,1-2H3 |
| InChIKey | KONHQYCOURZWFM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 56.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]-1,3-benzoxazol-2-one?
The IUPAC name of 3-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]-1,3-benzoxazol-2-one (CID 110219622) is 3-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]-1,3-benzoxazol-2-one.
What is the SMILES notation for 3-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]-1,3-benzoxazol-2-one?
The canonical SMILES for 3-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]-1,3-benzoxazol-2-one is Cc1c(CN2CCCC(n3c(=O)oc4ccccc43)C2)cnn1C.
What is the InChIKey of 3-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]-1,3-benzoxazol-2-one?
The InChIKey is KONHQYCOURZWFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4O2/c1-13-14(10-19-20(13)2)11-21-9-5-6-15(12-21)22-16-7-3-4-8-17(16)24-18(22)23/h3-4,7-8,10,15H,5-6,9,11-12H2,1-2H3.
What are the key properties of 3-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]-1,3-benzoxazol-2-one?
3-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]-1,3-benzoxazol-2-one has a molecular weight of 326.40 g/mol, XLogP of 2.47, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]-1,3-benzoxazol-2-one is sourced from PubChem (CID 110219622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).