About [3-(methylamino)-2,3-dihydro-1H-inden-4-yl] N,N-dimethylcarbamate
[3-(methylamino)-2,3-dihydro-1H-inden-4-yl] N,N-dimethylcarbamate (PubChem CID 11021981) has the molecular formula C13H18N2O2
and a molecular weight of 234.30 g/mol. Its IUPAC name is [3-(methylamino)-2,3-dihydro-1H-inden-4-yl] N,N-dimethylcarbamate.
Molecular Properties
| Compound Name | [3-(methylamino)-2,3-dihydro-1H-inden-4-yl] N,N-dimethylcarbamate |
| PubChem CID | 11021981 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | [3-(methylamino)-2,3-dihydro-1H-inden-4-yl] N,N-dimethylcarbamate |
| SMILES | CNC1CCc2cccc(OC(=O)N(C)C)c21 |
| InChI | InChI=1S/C13H18N2O2/c1-14-10-8-7-9-5-4-6-11(12(9)10)17-13(16)15(2)3/h4-6,10,14H,7-8H2,1-3H3 |
| InChIKey | VRYWLUPKBUBPFK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(methylamino)-2,3-dihydro-1H-inden-4-yl] N,N-dimethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(methylamino)-2,3-dihydro-1H-inden-4-yl] N,N-dimethylcarbamate?
The IUPAC name of [3-(methylamino)-2,3-dihydro-1H-inden-4-yl] N,N-dimethylcarbamate (CID 11021981) is [3-(methylamino)-2,3-dihydro-1H-inden-4-yl] N,N-dimethylcarbamate.
What is the SMILES notation for [3-(methylamino)-2,3-dihydro-1H-inden-4-yl] N,N-dimethylcarbamate?
The canonical SMILES for [3-(methylamino)-2,3-dihydro-1H-inden-4-yl] N,N-dimethylcarbamate is CNC1CCc2cccc(OC(=O)N(C)C)c21.
What is the InChIKey of [3-(methylamino)-2,3-dihydro-1H-inden-4-yl] N,N-dimethylcarbamate?
The InChIKey is VRYWLUPKBUBPFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O2/c1-14-10-8-7-9-5-4-6-11(12(9)10)17-13(16)15(2)3/h4-6,10,14H,7-8H2,1-3H3.
What are the key properties of [3-(methylamino)-2,3-dihydro-1H-inden-4-yl] N,N-dimethylcarbamate?
[3-(methylamino)-2,3-dihydro-1H-inden-4-yl] N,N-dimethylcarbamate has a molecular weight of 234.30 g/mol, XLogP of 1.95, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(methylamino)-2,3-dihydro-1H-inden-4-yl] N,N-dimethylcarbamate is sourced from PubChem (CID 11021981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).