C15H32O2Si — CID 11022046
(4S,6S)-2,2-ditert-butyl-4-methyl-6-propan-2-yl-1,3,2-dioxasilinane (PubChem CID 11022046) has the molecular formula C15H32O2Si and a molecular weight of 272.50 g/mol. Its IUPAC name is (4S,6S)-2,2-ditert-butyl-4-methyl-6-propan-2-yl-1,3,2-dioxasilinane.
| Compound Name | (4S,6S)-2,2-ditert-butyl-4-methyl-6-propan-2-yl-1,3,2-dioxasilinane |
|---|---|
| PubChem CID | 11022046 |
| Molecular Formula | C15H32O2Si |
| Molecular Weight | 272.50 g/mol |
| Exact Mass | 272.22 |
| IUPAC Name | (4S,6S)-2,2-ditert-butyl-4-methyl-6-propan-2-yl-1,3,2-dioxasilinane |
| SMILES | CC(C)[C@@H]1C[C@H](C)O[Si](C(C)(C)C)(C(C)(C)C)O1 |
| InChI | InChI=1S/C15H32O2Si/c1-11(2)13-10-12(3)16-18(17-13,14(4,5)6)15(7,8)9/h11-13H,10H2,1-9H3/t12-,13-/m0/s1 |
| InChIKey | MNLMLRMRVATKOA-STQMWFEESA-N |
| XLogP | 4.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.50 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|