C20H24N4OS — CID 110220704
(1-methylimidazol-2-yl)-[2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]phenyl]methanol (PubChem CID 110220704) has the molecular formula C20H24N4OS and a molecular weight of 368.51 g/mol. Its IUPAC name is (1-methylimidazol-2-yl)-[2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]phenyl]methanol.
| Compound Name | (1-methylimidazol-2-yl)-[2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]phenyl]methanol |
|---|---|
| PubChem CID | 110220704 |
| Molecular Formula | C20H24N4OS |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (1-methylimidazol-2-yl)-[2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]phenyl]methanol |
| SMILES | Cn1ccnc1C(O)c1ccccc1N1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C20H24N4OS/c1-22-9-8-21-20(22)19(25)17-6-2-3-7-18(17)24-12-10-23(11-13-24)15-16-5-4-14-26-16/h2-9,14,19,25H,10-13,15H2,1H3 |
| InChIKey | BWIHSFUXQRNRGL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |