C19H34O — CID 11022252
(2S,3S)-2-propyl-3-[(1Z,4Z)-tetradeca-1,4-dienyl]oxirane (PubChem CID 11022252) has the molecular formula C19H34O and a molecular weight of 278.48 g/mol. Its IUPAC name is (2S,3S)-2-propyl-3-[(1Z,4Z)-tetradeca-1,4-dienyl]oxirane.
| Compound Name | (2S,3S)-2-propyl-3-[(1Z,4Z)-tetradeca-1,4-dienyl]oxirane |
|---|---|
| PubChem CID | 11022252 |
| Molecular Formula | C19H34O |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.26 |
| IUPAC Name | (2S,3S)-2-propyl-3-[(1Z,4Z)-tetradeca-1,4-dienyl]oxirane |
| SMILES | CCCCCCCCC/C=C\C/C=C\[C@@H]1O[C@H]1CCC |
| InChI | InChI=1S/C19H34O/c1-3-5-6-7-8-9-10-11-12-13-14-15-17-19-18(20-19)16-4-2/h12-13,15,17-19H,3-11,14,16H2,1-2H3/b13-12-,17-15-/t18-,19-/m0/s1 |
| InChIKey | XITUWYPEDNZLOT-HKGUKXKYSA-N |
| XLogP | 6.20 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|