C21H23ClN2O3 — CID 110223345
2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-4-pyridin-3-yl-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol (PubChem CID 110223345) has the molecular formula C21H23ClN2O3 and a molecular weight of 386.88 g/mol. Its IUPAC name is 2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-4-pyridin-3-yl-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol.
| Compound Name | 2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-4-pyridin-3-yl-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol |
|---|---|
| PubChem CID | 110223345 |
| Molecular Formula | C21H23ClN2O3 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-4-pyridin-3-yl-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol |
| SMILES | OC1(c2cccnc2)CCCC2CN(Cc3cc4c(cc3Cl)OCO4)CC21 |
| InChI | InChI=1S/C21H23ClN2O3/c22-18-8-20-19(26-13-27-20)7-15(18)11-24-10-14-3-1-5-21(25,17(14)12-24)16-4-2-6-23-9-16/h2,4,6-9,14,17,25H,1,3,5,10-13H2 |
| InChIKey | SSUXVZYXEZIFCA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |