C18H19NO2 — CID 11022342
ethyl (2S,3R)-2-methyl-1,3-diphenylaziridine-2-carboxylate (PubChem CID 11022342) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is ethyl (2S,3R)-2-methyl-1,3-diphenylaziridine-2-carboxylate.
| Compound Name | ethyl (2S,3R)-2-methyl-1,3-diphenylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 11022342 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | ethyl (2S,3R)-2-methyl-1,3-diphenylaziridine-2-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)[C@@H](c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C18H19NO2/c1-3-21-17(20)18(2)16(14-10-6-4-7-11-14)19(18)15-12-8-5-9-13-15/h4-13,16H,3H2,1-2H3/t16-,18+,19?/m1/s1 |
| InChIKey | CSASJGZCUZUWHL-FAZYOCGDSA-N |
| XLogP | 3.57 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|