C21H24N4O3S — CID 110223740
2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(1-pyridin-2-yl-2-thiophen-2-ylethyl)acetamide (PubChem CID 110223740) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(1-pyridin-2-yl-2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(1-pyridin-2-yl-2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 110223740 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(1-pyridin-2-yl-2-thiophen-2-ylethyl)acetamide |
| SMILES | O=C(CN1C(=O)NC2(CCCCC2)C1=O)NC(Cc1cccs1)c1ccccn1 |
| InChI | InChI=1S/C21H24N4O3S/c26-18(14-25-19(27)21(24-20(25)28)9-3-1-4-10-21)23-17(13-15-7-6-12-29-15)16-8-2-5-11-22-16/h2,5-8,11-12,17H,1,3-4,9-10,13-14H2,(H,23,26)(H,24,28) |
| InChIKey | ONYREJZNCHNOHX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|