C18H26N4O2 — CID 110224337
2-tert-butyl-5-[1-(3,6-dihydro-2H-pyran-5-ylmethylamino)ethyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 110224337) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 2-tert-butyl-5-[1-(3,6-dihydro-2H-pyran-5-ylmethylamino)ethyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 2-tert-butyl-5-[1-(3,6-dihydro-2H-pyran-5-ylmethylamino)ethyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 110224337 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 2-tert-butyl-5-[1-(3,6-dihydro-2H-pyran-5-ylmethylamino)ethyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | CC(NCC1=CCCOC1)c1cc(=O)n2[nH]c(C(C)(C)C)cc2n1 |
| InChI | InChI=1S/C18H26N4O2/c1-12(19-10-13-6-5-7-24-11-13)14-8-17(23)22-16(20-14)9-15(21-22)18(2,3)4/h6,8-9,12,19,21H,5,7,10-11H2,1-4H3 |
| InChIKey | HUWIRNMUIHVRDU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|