About 4-benzyl-N-(2-chloro-4,5-difluorophenyl)piperazine-1-carboxamide
4-benzyl-N-(2-chloro-4,5-difluorophenyl)piperazine-1-carboxamide (PubChem CID 1102247) has the molecular formula C18H18ClF2N3O
and a molecular weight of 365.81 g/mol. Its IUPAC name is 4-benzyl-N-(2-chloro-4,5-difluorophenyl)piperazine-1-carboxamide.
Molecular Properties
| Compound Name | 4-benzyl-N-(2-chloro-4,5-difluorophenyl)piperazine-1-carboxamide |
| PubChem CID | 1102247 |
| Molecular Formula | C18H18ClF2N3O |
| Molecular Weight | 365.81 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 4-benzyl-N-(2-chloro-4,5-difluorophenyl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1cc(F)c(F)cc1Cl)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H18ClF2N3O/c19-14-10-15(20)16(21)11-17(14)22-18(25)24-8-6-23(7-9-24)12-13-4-2-1-3-5-13/h1-5,10-11H,6-9,12H2,(H,22,25) |
| InChIKey | GVFCESGZTADECV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.81 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-benzyl-N-(2-chloro-4,5-difluorophenyl)piperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-N-(2-chloro-4,5-difluorophenyl)piperazine-1-carboxamide?
The IUPAC name of 4-benzyl-N-(2-chloro-4,5-difluorophenyl)piperazine-1-carboxamide (CID 1102247) is 4-benzyl-N-(2-chloro-4,5-difluorophenyl)piperazine-1-carboxamide.
What is the SMILES notation for 4-benzyl-N-(2-chloro-4,5-difluorophenyl)piperazine-1-carboxamide?
The canonical SMILES for 4-benzyl-N-(2-chloro-4,5-difluorophenyl)piperazine-1-carboxamide is O=C(Nc1cc(F)c(F)cc1Cl)N1CCN(Cc2ccccc2)CC1.
What is the InChIKey of 4-benzyl-N-(2-chloro-4,5-difluorophenyl)piperazine-1-carboxamide?
The InChIKey is GVFCESGZTADECV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18ClF2N3O/c19-14-10-15(20)16(21)11-17(14)22-18(25)24-8-6-23(7-9-24)12-13-4-2-1-3-5-13/h1-5,10-11H,6-9,12H2,(H,22,25).
What are the key properties of 4-benzyl-N-(2-chloro-4,5-difluorophenyl)piperazine-1-carboxamide?
4-benzyl-N-(2-chloro-4,5-difluorophenyl)piperazine-1-carboxamide has a molecular weight of 365.81 g/mol, XLogP of 3.97, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-N-(2-chloro-4,5-difluorophenyl)piperazine-1-carboxamide is sourced from PubChem (CID 1102247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).