C18H25NO2 — CID 11022525
[(2S,4aS,7R,8aR)-4,4,7-trimethyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazin-2-yl]-phenylmethanone (PubChem CID 11022525) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is [(2S,4aS,7R,8aR)-4,4,7-trimethyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazin-2-yl]-phenylmethanone.
| Compound Name | [(2S,4aS,7R,8aR)-4,4,7-trimethyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazin-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 11022525 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | [(2S,4aS,7R,8aR)-4,4,7-trimethyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazin-2-yl]-phenylmethanone |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@@H](C(=O)c1ccccc1)NC2(C)C |
| InChI | InChI=1S/C18H25NO2/c1-12-9-10-14-15(11-12)21-17(19-18(14,2)3)16(20)13-7-5-4-6-8-13/h4-8,12,14-15,17,19H,9-11H2,1-3H3/t12-,14-,15-,17+/m1/s1 |
| InChIKey | BAXJDAFEGJUYKF-MMTVNHQJSA-N |
| XLogP | 3.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |