C18H22N6O3S — CID 110225274
2-(3,5-dimethyl-1,2,4-triazol-1-yl)-1-[3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)piperidin-1-yl]ethanone (PubChem CID 110225274) has the molecular formula C18H22N6O3S and a molecular weight of 402.48 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1,2,4-triazol-1-yl)-1-[3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)piperidin-1-yl]ethanone.
| Compound Name | 2-(3,5-dimethyl-1,2,4-triazol-1-yl)-1-[3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 110225274 |
| Molecular Formula | C18H22N6O3S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 2-(3,5-dimethyl-1,2,4-triazol-1-yl)-1-[3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)piperidin-1-yl]ethanone |
| SMILES | Cc1nc(C)n(CC(=O)N2CCCC(C3=NS(=O)(=O)c4ccccc4N3)C2)n1 |
| InChI | InChI=1S/C18H22N6O3S/c1-12-19-13(2)24(21-12)11-17(25)23-9-5-6-14(10-23)18-20-15-7-3-4-8-16(15)28(26,27)22-18/h3-4,7-8,14H,5-6,9-11H2,1-2H3,(H,20,22) |
| InChIKey | FLGXAACAHFFZMW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 109.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |