About N-(oxan-3-yl)-3-(3,4,5-trimethylpyrazol-1-yl)propanamide
N-(oxan-3-yl)-3-(3,4,5-trimethylpyrazol-1-yl)propanamide (PubChem CID 110226048) has the molecular formula C14H23N3O2
and a molecular weight of 265.36 g/mol. Its IUPAC name is N-(oxan-3-yl)-3-(3,4,5-trimethylpyrazol-1-yl)propanamide.
Molecular Properties
| Compound Name | N-(oxan-3-yl)-3-(3,4,5-trimethylpyrazol-1-yl)propanamide |
| PubChem CID | 110226048 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | N-(oxan-3-yl)-3-(3,4,5-trimethylpyrazol-1-yl)propanamide |
| SMILES | Cc1nn(CCC(=O)NC2CCCOC2)c(C)c1C |
| InChI | InChI=1S/C14H23N3O2/c1-10-11(2)16-17(12(10)3)7-6-14(18)15-13-5-4-8-19-9-13/h13H,4-9H2,1-3H3,(H,15,18) |
| InChIKey | ZBVZKJCEOQEROF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(oxan-3-yl)-3-(3,4,5-trimethylpyrazol-1-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(oxan-3-yl)-3-(3,4,5-trimethylpyrazol-1-yl)propanamide?
The IUPAC name of N-(oxan-3-yl)-3-(3,4,5-trimethylpyrazol-1-yl)propanamide (CID 110226048) is N-(oxan-3-yl)-3-(3,4,5-trimethylpyrazol-1-yl)propanamide.
What is the SMILES notation for N-(oxan-3-yl)-3-(3,4,5-trimethylpyrazol-1-yl)propanamide?
The canonical SMILES for N-(oxan-3-yl)-3-(3,4,5-trimethylpyrazol-1-yl)propanamide is Cc1nn(CCC(=O)NC2CCCOC2)c(C)c1C.
What is the InChIKey of N-(oxan-3-yl)-3-(3,4,5-trimethylpyrazol-1-yl)propanamide?
The InChIKey is ZBVZKJCEOQEROF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O2/c1-10-11(2)16-17(12(10)3)7-6-14(18)15-13-5-4-8-19-9-13/h13H,4-9H2,1-3H3,(H,15,18).
What are the key properties of N-(oxan-3-yl)-3-(3,4,5-trimethylpyrazol-1-yl)propanamide?
N-(oxan-3-yl)-3-(3,4,5-trimethylpyrazol-1-yl)propanamide has a molecular weight of 265.36 g/mol, XLogP of 1.49, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(oxan-3-yl)-3-(3,4,5-trimethylpyrazol-1-yl)propanamide is sourced from PubChem (CID 110226048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).