C13H14N2S — CID 110226064
2-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-4-yl)aniline (PubChem CID 110226064) has the molecular formula C13H14N2S and a molecular weight of 230.34 g/mol. Its IUPAC name is 2-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-4-yl)aniline.
| Compound Name | 2-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-4-yl)aniline |
|---|---|
| PubChem CID | 110226064 |
| Molecular Formula | C13H14N2S |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 2-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-4-yl)aniline |
| SMILES | Nc1ccccc1C1NCCc2sccc21 |
| InChI | InChI=1S/C13H14N2S/c14-11-4-2-1-3-9(11)13-10-6-8-16-12(10)5-7-15-13/h1-4,6,8,13,15H,5,7,14H2 |
| InChIKey | UXCIGRIUPYHDIQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|