About 3-[1-[(1,3-dimethylpyrazol-4-yl)methyl]azepan-2-yl]-5-methyl-1,2-oxazole
3-[1-[(1,3-dimethylpyrazol-4-yl)methyl]azepan-2-yl]-5-methyl-1,2-oxazole (PubChem CID 110226118) has the molecular formula C16H24N4O
and a molecular weight of 288.39 g/mol. Its IUPAC name is 3-[1-[(1,3-dimethylpyrazol-4-yl)methyl]azepan-2-yl]-5-methyl-1,2-oxazole.
Molecular Properties
| Compound Name | 3-[1-[(1,3-dimethylpyrazol-4-yl)methyl]azepan-2-yl]-5-methyl-1,2-oxazole |
| PubChem CID | 110226118 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 3-[1-[(1,3-dimethylpyrazol-4-yl)methyl]azepan-2-yl]-5-methyl-1,2-oxazole |
| SMILES | Cc1cc(C2CCCCCN2Cc2cn(C)nc2C)no1 |
| InChI | InChI=1S/C16H24N4O/c1-12-9-15(18-21-12)16-7-5-4-6-8-20(16)11-14-10-19(3)17-13(14)2/h9-10,16H,4-8,11H2,1-3H3 |
| InChIKey | HQWYTKDXMUYLLS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 47.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[1-[(1,3-dimethylpyrazol-4-yl)methyl]azepan-2-yl]-5-methyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-[(1,3-dimethylpyrazol-4-yl)methyl]azepan-2-yl]-5-methyl-1,2-oxazole?
The IUPAC name of 3-[1-[(1,3-dimethylpyrazol-4-yl)methyl]azepan-2-yl]-5-methyl-1,2-oxazole (CID 110226118) is 3-[1-[(1,3-dimethylpyrazol-4-yl)methyl]azepan-2-yl]-5-methyl-1,2-oxazole.
What is the SMILES notation for 3-[1-[(1,3-dimethylpyrazol-4-yl)methyl]azepan-2-yl]-5-methyl-1,2-oxazole?
The canonical SMILES for 3-[1-[(1,3-dimethylpyrazol-4-yl)methyl]azepan-2-yl]-5-methyl-1,2-oxazole is Cc1cc(C2CCCCCN2Cc2cn(C)nc2C)no1.
What is the InChIKey of 3-[1-[(1,3-dimethylpyrazol-4-yl)methyl]azepan-2-yl]-5-methyl-1,2-oxazole?
The InChIKey is HQWYTKDXMUYLLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N4O/c1-12-9-15(18-21-12)16-7-5-4-6-8-20(16)11-14-10-19(3)17-13(14)2/h9-10,16H,4-8,11H2,1-3H3.
What are the key properties of 3-[1-[(1,3-dimethylpyrazol-4-yl)methyl]azepan-2-yl]-5-methyl-1,2-oxazole?
3-[1-[(1,3-dimethylpyrazol-4-yl)methyl]azepan-2-yl]-5-methyl-1,2-oxazole has a molecular weight of 288.39 g/mol, XLogP of 3.14, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-[(1,3-dimethylpyrazol-4-yl)methyl]azepan-2-yl]-5-methyl-1,2-oxazole is sourced from PubChem (CID 110226118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).