C16H21NO4 — CID 11022655
benzyl (4aS,8aR)-2-hydroxy-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyridine-5-carboxylate (PubChem CID 11022655) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is benzyl (4aS,8aR)-2-hydroxy-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyridine-5-carboxylate.
| Compound Name | benzyl (4aS,8aR)-2-hydroxy-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 11022655 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | benzyl (4aS,8aR)-2-hydroxy-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyridine-5-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC[C@H]2OC(O)CC[C@@H]21 |
| InChI | InChI=1S/C16H21NO4/c18-15-9-8-13-14(21-15)7-4-10-17(13)16(19)20-11-12-5-2-1-3-6-12/h1-3,5-6,13-15,18H,4,7-11H2/t13-,14+,15?/m0/s1 |
| InChIKey | DDOGUPJKFPANKE-SNTRVMSOSA-N |
| XLogP | 2.29 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |