C16H20O5 — CID 11022689
(3aR,5R,6S,6aR)-2,2-dimethyl-5-[(2S)-oxiran-2-yl]-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 11022689) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-2,2-dimethyl-5-[(2S)-oxiran-2-yl]-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-2,2-dimethyl-5-[(2S)-oxiran-2-yl]-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 11022689 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (3aR,5R,6S,6aR)-2,2-dimethyl-5-[(2S)-oxiran-2-yl]-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@@H]3CO3)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C16H20O5/c1-16(2)20-14-13(18-8-10-6-4-3-5-7-10)12(11-9-17-11)19-15(14)21-16/h3-7,11-15H,8-9H2,1-2H3/t11-,12+,13-,14+,15+/m0/s1 |
| InChIKey | DLIZGFMSHQWPGV-XPABHHOTSA-N |
| XLogP | 1.85 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|