C23H29N5O2S — CID 110227225
12-(2-methylpropanoyl)-5-[1-[(3-methylthiophen-2-yl)methyl]pyrrolidin-2-yl]-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 110227225) has the molecular formula C23H29N5O2S and a molecular weight of 439.59 g/mol. Its IUPAC name is 12-(2-methylpropanoyl)-5-[1-[(3-methylthiophen-2-yl)methyl]pyrrolidin-2-yl]-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 12-(2-methylpropanoyl)-5-[1-[(3-methylthiophen-2-yl)methyl]pyrrolidin-2-yl]-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 110227225 |
| Molecular Formula | C23H29N5O2S |
| Molecular Weight | 439.59 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 12-(2-methylpropanoyl)-5-[1-[(3-methylthiophen-2-yl)methyl]pyrrolidin-2-yl]-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | Cc1ccsc1CN1CCCC1c1cc2nc3c(c(=O)n2[nH]1)CCN(C(=O)C(C)C)C3 |
| InChI | InChI=1S/C23H29N5O2S/c1-14(2)22(29)27-9-6-16-18(12-27)24-21-11-17(25-28(21)23(16)30)19-5-4-8-26(19)13-20-15(3)7-10-31-20/h7,10-11,14,19,25H,4-6,8-9,12-13H2,1-3H3 |
| InChIKey | IZEZVTBZAFGNBH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 73.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.59 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |