C23H31N5O2 — CID 110229177
11-acetyl-5-[1-(cyclohex-3-en-1-ylmethyl)piperidin-2-yl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 110229177) has the molecular formula C23H31N5O2 and a molecular weight of 409.53 g/mol. Its IUPAC name is 11-acetyl-5-[1-(cyclohex-3-en-1-ylmethyl)piperidin-2-yl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 11-acetyl-5-[1-(cyclohex-3-en-1-ylmethyl)piperidin-2-yl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 110229177 |
| Molecular Formula | C23H31N5O2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | 11-acetyl-5-[1-(cyclohex-3-en-1-ylmethyl)piperidin-2-yl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | CC(=O)N1CCc2nc3cc(C4CCCCN4CC4CC=CCC4)[nH]n3c(=O)c2C1 |
| InChI | InChI=1S/C23H31N5O2/c1-16(29)26-12-10-19-18(15-26)23(30)28-22(24-19)13-20(25-28)21-9-5-6-11-27(21)14-17-7-3-2-4-8-17/h2-3,13,17,21,25H,4-12,14-15H2,1H3 |
| InChIKey | AROFVLYDNJBHLP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 73.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|