C26H28FN3O2 — CID 110229241
N-[[1-[(2-fluorophenyl)methyl]piperidin-3-yl]-pyridin-2-ylmethyl]-2-methoxybenzamide (PubChem CID 110229241) has the molecular formula C26H28FN3O2 and a molecular weight of 433.53 g/mol. Its IUPAC name is N-[[1-[(2-fluorophenyl)methyl]piperidin-3-yl]-pyridin-2-ylmethyl]-2-methoxybenzamide.
| Compound Name | N-[[1-[(2-fluorophenyl)methyl]piperidin-3-yl]-pyridin-2-ylmethyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 110229241 |
| Molecular Formula | C26H28FN3O2 |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | N-[[1-[(2-fluorophenyl)methyl]piperidin-3-yl]-pyridin-2-ylmethyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NC(c1ccccn1)C1CCCN(Cc2ccccc2F)C1 |
| InChI | InChI=1S/C26H28FN3O2/c1-32-24-14-5-3-11-21(24)26(31)29-25(23-13-6-7-15-28-23)20-10-8-16-30(18-20)17-19-9-2-4-12-22(19)27/h2-7,9,11-15,20,25H,8,10,16-18H2,1H3,(H,29,31) |
| InChIKey | RCCXDFAGLGPRER-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |